C24H25N7O2 — CID 133287591
methyl 2-[4-[4-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]piperazin-1-yl]acetate (PubChem CID 133287591) has the molecular formula C24H25N7O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is methyl 2-[4-[4-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[4-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 133287591 |
| Molecular Formula | C24H25N7O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | methyl 2-[4-[4-[(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(c2ccc(Nc3cc(-c4ccccc4)nc4ncnn34)cc2)CC1 |
| InChI | InChI=1S/C24H25N7O2/c1-33-23(32)16-29-11-13-30(14-12-29)20-9-7-19(8-10-20)27-22-15-21(18-5-3-2-4-6-18)28-24-25-17-26-31(22)24/h2-10,15,17,27H,11-14,16H2,1H3 |
| InChIKey | OGNSQANRIRUHML-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|