C24H21N7 — CID 133287796
N-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-1-phenyltetrazol-5-amine (PubChem CID 133287796) has the molecular formula C24H21N7 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 133287796 |
| Molecular Formula | C24H21N7 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-1-phenyltetrazol-5-amine |
| SMILES | c1ccc(-n2nnnc2NCc2ccccc2-c2ccc(Cn3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C24H21N7/c1-2-7-22(8-3-1)31-24(27-28-29-31)26-16-21-6-4-5-9-23(21)20-12-10-19(11-13-20)17-30-15-14-25-18-30/h1-15,18H,16-17H2,(H,26,27,29) |
| InChIKey | PJWSPZBKCFZGRY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |