C31H32O4P2 — CID 13328811
(4R,5R)-4,5-bis(diphenylphosphorylmethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 13328811) has the molecular formula C31H32O4P2 and a molecular weight of 530.54 g/mol. Its IUPAC name is (4R,5R)-4,5-bis(diphenylphosphorylmethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4,5-bis(diphenylphosphorylmethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 13328811 |
| Molecular Formula | C31H32O4P2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (4R,5R)-4,5-bis(diphenylphosphorylmethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H](CP(=O)(c2ccccc2)c2ccccc2)[C@H](CP(=O)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C31H32O4P2/c1-31(2)34-29(23-36(32,25-15-7-3-8-16-25)26-17-9-4-10-18-26)30(35-31)24-37(33,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,29-30H,23-24H2,1-2H3/t29-,30-/m0/s1 |
| InChIKey | KZUJPJPWSHHJRQ-KYJUHHDHSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|