C13H17N5O — CID 133290493
2-methyl-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]morpholine (PubChem CID 133290493) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-methyl-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]morpholine.
| Compound Name | 2-methyl-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]morpholine |
|---|---|
| PubChem CID | 133290493 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-methyl-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]morpholine |
| SMILES | Cc1ccn(-c2ccc(N3CCOC(C)C3)nn2)n1 |
| InChI | InChI=1S/C13H17N5O/c1-10-5-6-18(16-10)13-4-3-12(14-15-13)17-7-8-19-11(2)9-17/h3-6,11H,7-9H2,1-2H3 |
| InChIKey | YOVLMPIOYBOAOB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |