About 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide
4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide (PubChem CID 133290912) has the molecular formula C20H21N5O
and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide.
Molecular Properties
| Compound Name | 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide |
| PubChem CID | 133290912 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CNc2nc(-c3ccccn3)nc(C)c2C)cc1 |
| InChI | InChI=1S/C20H21N5O/c1-13-14(2)24-19(17-6-4-5-11-22-17)25-18(13)23-12-15-7-9-16(10-8-15)20(26)21-3/h4-11H,12H2,1-3H3,(H,21,26)(H,23,24,25) |
| InChIKey | IIVOHZMERDRVCV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide?
The IUPAC name of 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide (CID 133290912) is 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide.
What is the SMILES notation for 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide?
The canonical SMILES for 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide is CNC(=O)c1ccc(CNc2nc(-c3ccccn3)nc(C)c2C)cc1.
What is the InChIKey of 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide?
The InChIKey is IIVOHZMERDRVCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N5O/c1-13-14(2)24-19(17-6-4-5-11-22-17)25-18(13)23-12-15-7-9-16(10-8-15)20(26)21-3/h4-11H,12H2,1-3H3,(H,21,26)(H,23,24,25).
What are the key properties of 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide?
4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide has a molecular weight of 347.42 g/mol, XLogP of 3.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)amino]methyl]-N-methylbenzamide is sourced from PubChem (CID 133290912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).