About 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide
2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 133291242) has the molecular formula C18H16F2N4O4S
and a molecular weight of 422.41 g/mol. Its IUPAC name is 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide |
| PubChem CID | 133291242 |
| Molecular Formula | C18H16F2N4O4S |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNc1ccc(S(=O)(=O)Nc2cc(F)cc(F)c2)cn1)NCc1ccco1 |
| InChI | InChI=1S/C18H16F2N4O4S/c19-12-6-13(20)8-14(7-12)24-29(26,27)16-3-4-17(21-10-16)22-11-18(25)23-9-15-2-1-5-28-15/h1-8,10,24H,9,11H2,(H,21,22)(H,23,25) |
| InChIKey | MYSLJEQNRYIQSD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide?
The IUPAC name of 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide (CID 133291242) is 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide.
What is the SMILES notation for 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide?
The canonical SMILES for 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide is O=C(CNc1ccc(S(=O)(=O)Nc2cc(F)cc(F)c2)cn1)NCc1ccco1.
What is the InChIKey of 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide?
The InChIKey is MYSLJEQNRYIQSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N4O4S/c19-12-6-13(20)8-14(7-12)24-29(26,27)16-3-4-17(21-10-16)22-11-18(25)23-9-15-2-1-5-28-15/h1-8,10,24H,9,11H2,(H,21,22)(H,23,25).
What are the key properties of 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide?
2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide has a molecular weight of 422.41 g/mol, XLogP of 2.48, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]-N-(furan-2-ylmethyl)acetamide is sourced from PubChem (CID 133291242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).