C16H18N2O4S2 — CID 133291800
4-[(2,5-dimethylphenyl)methylsulfanyl]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 133291800) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)methylsulfanyl]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2,5-dimethylphenyl)methylsulfanyl]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133291800 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)methylsulfanyl]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(SCc2cc(C)ccc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-11-4-5-12(2)13(8-11)10-23-16-7-6-14(24(21,22)17-3)9-15(16)18(19)20/h4-9,17H,10H2,1-3H3 |
| InChIKey | XMGRLYSCKTXQST-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|