C18H20N4S — CID 133292367
6-ethyl-N-(1-phenylpyrrolidin-3-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133292367) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 6-ethyl-N-(1-phenylpyrrolidin-3-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-N-(1-phenylpyrrolidin-3-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133292367 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6-ethyl-N-(1-phenylpyrrolidin-3-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NC3CCN(c4ccccc4)C3)ncnc2s1 |
| InChI | InChI=1S/C18H20N4S/c1-2-15-10-16-17(19-12-20-18(16)23-15)21-13-8-9-22(11-13)14-6-4-3-5-7-14/h3-7,10,12-13H,2,8-9,11H2,1H3,(H,19,20,21) |
| InChIKey | VAEDTYLAKKCPIH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |