About 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one
4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one (PubChem CID 133292422) has the molecular formula C15H13Cl3FN3O2
and a molecular weight of 392.65 g/mol. Its IUPAC name is 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one |
| PubChem CID | 133292422 |
| Molecular Formula | C15H13Cl3FN3O2 |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(N2CCOC(c3cc(F)c(Cl)cc3Cl)C2)c(Cl)c1=O |
| InChI | InChI=1S/C15H13Cl3FN3O2/c1-21-15(23)14(18)12(6-20-21)22-2-3-24-13(7-22)8-4-11(19)10(17)5-9(8)16/h4-6,13H,2-3,7H2,1H3 |
| InChIKey | AFHOZKDSRSQAQF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one?
The IUPAC name of 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one (CID 133292422) is 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one.
What is the SMILES notation for 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one?
The canonical SMILES for 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one is Cn1ncc(N2CCOC(c3cc(F)c(Cl)cc3Cl)C2)c(Cl)c1=O.
What is the InChIKey of 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one?
The InChIKey is AFHOZKDSRSQAQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl3FN3O2/c1-21-15(23)14(18)12(6-20-21)22-2-3-24-13(7-22)8-4-11(19)10(17)5-9(8)16/h4-6,13H,2-3,7H2,1H3.
What are the key properties of 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one?
4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one has a molecular weight of 392.65 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-methylpyridazin-3-one is sourced from PubChem (CID 133292422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).