C13H18N4S — CID 133292488
N-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]pyrazin-2-amine (PubChem CID 133292488) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]pyrazin-2-amine.
| Compound Name | N-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 133292488 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]pyrazin-2-amine |
| SMILES | CC(Nc1cnccn1)c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C13H18N4S/c1-9(16-11-7-14-5-6-15-11)12-17-10(8-18-12)13(2,3)4/h5-9H,1-4H3,(H,15,16) |
| InChIKey | UKHOAYWQBYCRJU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |