C13H11NO3 — CID 13329306
3,5-dimethyl-3H-furo[3,2-c]quinoline-2,4-dione (PubChem CID 13329306) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 3,5-dimethyl-3H-furo[3,2-c]quinoline-2,4-dione.
| Compound Name | 3,5-dimethyl-3H-furo[3,2-c]quinoline-2,4-dione |
|---|---|
| PubChem CID | 13329306 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3,5-dimethyl-3H-furo[3,2-c]quinoline-2,4-dione |
| SMILES | CC1C(=O)Oc2c1c(=O)n(C)c1ccccc21 |
| InChI | InChI=1S/C13H11NO3/c1-7-10-11(17-13(7)16)8-5-3-4-6-9(8)14(2)12(10)15/h3-7H,1-2H3 |
| InChIKey | NLEDZHBPEFSDTG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |