C16H20N8 — CID 133294975
3-cyclopropyl-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133294975) has the molecular formula C16H20N8 and a molecular weight of 324.39 g/mol. Its IUPAC name is 3-cyclopropyl-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-cyclopropyl-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133294975 |
| Molecular Formula | C16H20N8 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-cyclopropyl-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CCc1nc2n(n1)CC(Nc1ccc3nnc(C4CC4)n3n1)CC2 |
| InChI | InChI=1S/C16H20N8/c1-2-12-18-14-7-5-11(9-23(14)21-12)17-13-6-8-15-19-20-16(10-3-4-10)24(15)22-13/h6,8,10-11H,2-5,7,9H2,1H3,(H,17,22) |
| InChIKey | OBTKHIUXRKKMGI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |