About 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile
2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile (PubChem CID 133295832) has the molecular formula C16H12F2N2O
and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile |
| PubChem CID | 133295832 |
| Molecular Formula | C16H12F2N2O |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile |
| SMILES | N#Cc1c(F)cccc1NC1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C16H12F2N2O/c17-10-4-5-16-11(8-10)15(6-7-21-16)20-14-3-1-2-13(18)12(14)9-19/h1-5,8,15,20H,6-7H2 |
| InChIKey | BZGVGOBGRUNGOV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile?
The IUPAC name of 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile (CID 133295832) is 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile.
What is the SMILES notation for 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile?
The canonical SMILES for 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile is N#Cc1c(F)cccc1NC1CCOc2ccc(F)cc21.
What is the InChIKey of 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile?
The InChIKey is BZGVGOBGRUNGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2O/c17-10-4-5-16-11(8-10)15(6-7-21-16)20-14-3-1-2-13(18)12(14)9-19/h1-5,8,15,20H,6-7H2.
What are the key properties of 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile?
2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile has a molecular weight of 286.28 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)amino]benzonitrile is sourced from PubChem (CID 133295832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).