C9H19BO2Si — CID 13329733
2,6-diethyl-4,4,5-trimethyl-1,3,4,2-dioxasilaborinine (PubChem CID 13329733) has the molecular formula C9H19BO2Si and a molecular weight of 198.15 g/mol. Its IUPAC name is 2,6-diethyl-4,4,5-trimethyl-1,3,4,2-dioxasilaborinine.
| Compound Name | 2,6-diethyl-4,4,5-trimethyl-1,3,4,2-dioxasilaborinine |
|---|---|
| PubChem CID | 13329733 |
| Molecular Formula | C9H19BO2Si |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2,6-diethyl-4,4,5-trimethyl-1,3,4,2-dioxasilaborinine |
| SMILES | CCB1OC(CC)=C(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C9H19BO2Si/c1-6-9-8(3)13(4,5)12-10(7-2)11-9/h6-7H2,1-5H3 |
| InChIKey | HWCKAKDIPBFXSH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|