About sodium tritert-butylsilanide
sodium tritert-butylsilanide (PubChem CID 13329819) has the molecular formula C12H27NaSi
and a molecular weight of 222.42 g/mol. Its IUPAC name is sodium tritert-butylsilanide.
Molecular Properties
| Compound Name | sodium tritert-butylsilanide |
| PubChem CID | 13329819 |
| Molecular Formula | C12H27NaSi |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | sodium tritert-butylsilanide |
| SMILES | CC(C)(C)[Si-](C(C)(C)C)C(C)(C)C.[Na+] |
| InChI | InChI=1S/C12H27Si.Na/c1-10(2,3)13(11(4,5)6)12(7,8)9;/h1-9H3;/q-1;+1 |
| InChIKey | BIHQRKGZUDWWGS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium tritert-butylsilanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium tritert-butylsilanide?
The IUPAC name of sodium tritert-butylsilanide (CID 13329819) is sodium tritert-butylsilanide.
What is the SMILES notation for sodium tritert-butylsilanide?
The canonical SMILES for sodium tritert-butylsilanide is CC(C)(C)[Si-](C(C)(C)C)C(C)(C)C.[Na+].
What is the InChIKey of sodium tritert-butylsilanide?
The InChIKey is BIHQRKGZUDWWGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27Si.Na/c1-10(2,3)13(11(4,5)6)12(7,8)9;/h1-9H3;/q-1;+1.
What are the key properties of sodium tritert-butylsilanide?
sodium tritert-butylsilanide has a molecular weight of 222.42 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium tritert-butylsilanide is sourced from PubChem (CID 13329819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).