C21H22F2N2O3S — CID 133298637
3-[1-[2-(difluoromethylsulfonyl)phenyl]piperidin-4-yl]-5-methoxy-1H-indole (PubChem CID 133298637) has the molecular formula C21H22F2N2O3S and a molecular weight of 420.48 g/mol. Its IUPAC name is 3-[1-[2-(difluoromethylsulfonyl)phenyl]piperidin-4-yl]-5-methoxy-1H-indole.
| Compound Name | 3-[1-[2-(difluoromethylsulfonyl)phenyl]piperidin-4-yl]-5-methoxy-1H-indole |
|---|---|
| PubChem CID | 133298637 |
| Molecular Formula | C21H22F2N2O3S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-[1-[2-(difluoromethylsulfonyl)phenyl]piperidin-4-yl]-5-methoxy-1H-indole |
| SMILES | COc1ccc2[nH]cc(C3CCN(c4ccccc4S(=O)(=O)C(F)F)CC3)c2c1 |
| InChI | InChI=1S/C21H22F2N2O3S/c1-28-15-6-7-18-16(12-15)17(13-24-18)14-8-10-25(11-9-14)19-4-2-3-5-20(19)29(26,27)21(22)23/h2-7,12-14,21,24H,8-11H2,1H3 |
| InChIKey | GNNCGDPGESVEII-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |