About pyrrolidine-3,4-diol
pyrrolidine-3,4-diol (PubChem CID 13329881) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | pyrrolidine-3,4-diol |
| PubChem CID | 13329881 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | pyrrolidine-3,4-diol |
| SMILES | OC1CNCC1O |
| InChI | InChI=1S/C4H9NO2/c6-3-1-5-2-4(3)7/h3-7H,1-2H2 |
| InChIKey | JCZPOYAMKJFOLA-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-3,4-diol?
The IUPAC name of pyrrolidine-3,4-diol (CID 13329881) is pyrrolidine-3,4-diol.
What is the SMILES notation for pyrrolidine-3,4-diol?
The canonical SMILES for pyrrolidine-3,4-diol is OC1CNCC1O.
What is the InChIKey of pyrrolidine-3,4-diol?
The InChIKey is JCZPOYAMKJFOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2/c6-3-1-5-2-4(3)7/h3-7H,1-2H2.
What are the key properties of pyrrolidine-3,4-diol?
pyrrolidine-3,4-diol has a molecular weight of 103.12 g/mol, XLogP of -1.69, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-3,4-diol is sourced from PubChem (CID 13329881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).