C20H23FN6 — CID 133298868
N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 133298868) has the molecular formula C20H23FN6 and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133298868 |
| Molecular Formula | C20H23FN6 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | Cc1nccn1-c1ccc(CNc2cc(N3CCCCC3)ncn2)cc1F |
| InChI | InChI=1S/C20H23FN6/c1-15-22-7-10-27(15)18-6-5-16(11-17(18)21)13-23-19-12-20(25-14-24-19)26-8-3-2-4-9-26/h5-7,10-12,14H,2-4,8-9,13H2,1H3,(H,23,24,25) |
| InChIKey | VFVVLEHZESFQAA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |