C12H12N4 — CID 13329895
(4-cyanoimino-2,3,5,6-tetramethylcyclohexa-2,5-dien-1-ylidene)cyanamide (PubChem CID 13329895) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is (4-cyanoimino-2,3,5,6-tetramethylcyclohexa-2,5-dien-1-ylidene)cyanamide.
| Compound Name | (4-cyanoimino-2,3,5,6-tetramethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 13329895 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (4-cyanoimino-2,3,5,6-tetramethylcyclohexa-2,5-dien-1-ylidene)cyanamide |
| SMILES | CC1=C(C)C(=NC#N)C(C)=C(C)C1=NC#N |
| InChI | InChI=1S/C12H12N4/c1-7-8(2)12(16-6-14)10(4)9(3)11(7)15-5-13/h1-4H3/b15-11-,16-12+ |
| InChIKey | HEPHTMZCEOSLFT-UKVBVZPVSA-N |
| XLogP | 2.52 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|