About N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine
N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine (PubChem CID 133299000) has the molecular formula C14H21N5O
and a molecular weight of 275.36 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine |
| PubChem CID | 133299000 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine |
| SMILES | COCCn1nc(C)c(CNc2cc(C)ncn2)c1C |
| InChI | InChI=1S/C14H21N5O/c1-10-7-14(17-9-16-10)15-8-13-11(2)18-19(12(13)3)5-6-20-4/h7,9H,5-6,8H2,1-4H3,(H,15,16,17) |
| InChIKey | URSHFTLIKXMUBG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine?
The IUPAC name of N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine (CID 133299000) is N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine.
What is the SMILES notation for N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine?
The canonical SMILES for N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine is COCCn1nc(C)c(CNc2cc(C)ncn2)c1C.
What is the InChIKey of N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine?
The InChIKey is URSHFTLIKXMUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O/c1-10-7-14(17-9-16-10)15-8-13-11(2)18-19(12(13)3)5-6-20-4/h7,9H,5-6,8H2,1-4H3,(H,15,16,17).
What are the key properties of N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine?
N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine has a molecular weight of 275.36 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-6-methylpyrimidin-4-amine is sourced from PubChem (CID 133299000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).