C14H23O2+ — CID 1333
(10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium (PubChem CID 1333) has the molecular formula C14H23O2+ and a molecular weight of 223.34 g/mol. Its IUPAC name is (10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium.
| Compound Name | (10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium |
|---|---|
| PubChem CID | 1333 |
| Molecular Formula | C14H23O2+ |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium |
| SMILES | [H][O+]=C1C2CCCCC2C(O)C2CCCCC12 |
| InChI | InChI=1S/C14H22O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h9-13,15H,1-8H2/p+1 |
| InChIKey | NAFGJRMQTYNREJ-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|