C21H19N5O2 — CID 133300760
5-nitro-6-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]quinoline (PubChem CID 133300760) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 5-nitro-6-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]quinoline.
| Compound Name | 5-nitro-6-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]quinoline |
|---|---|
| PubChem CID | 133300760 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-nitro-6-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]quinoline |
| SMILES | O=[N+]([O-])c1c(N2CCC(c3c[nH]c4ncccc34)CC2)ccc2ncccc12 |
| InChI | InChI=1S/C21H19N5O2/c27-26(28)20-16-4-2-9-22-18(16)5-6-19(20)25-11-7-14(8-12-25)17-13-24-21-15(17)3-1-10-23-21/h1-6,9-10,13-14H,7-8,11-12H2,(H,23,24) |
| InChIKey | GGKLYCPZPCEQCC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|