C18H20F3N3O — CID 133302722
2-[(2-cyclopropylpyrimidin-4-yl)amino]-1-[4-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 133302722) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-[(2-cyclopropylpyrimidin-4-yl)amino]-1-[4-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | 2-[(2-cyclopropylpyrimidin-4-yl)amino]-1-[4-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 133302722 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[(2-cyclopropylpyrimidin-4-yl)amino]-1-[4-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | CCC(Nc1ccnc(C2CC2)n1)C(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F3N3O/c1-2-14(23-15-9-10-22-17(24-15)12-3-4-12)16(25)11-5-7-13(8-6-11)18(19,20)21/h5-10,12,14,16,25H,2-4H2,1H3,(H,22,23,24) |
| InChIKey | WLOAZJDCTDUXCQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |