C16H16BrF3N4O — CID 133302857
4-bromo-2-methyl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyridazin-3-one (PubChem CID 133302857) has the molecular formula C16H16BrF3N4O and a molecular weight of 417.23 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-bromo-2-methyl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 133302857 |
| Molecular Formula | C16H16BrF3N4O |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 4-bromo-2-methyl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyridazin-3-one |
| SMILES | Cn1ncc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)c(Br)c1=O |
| InChI | InChI=1S/C16H16BrF3N4O/c1-22-15(25)14(17)13(10-21-22)24-7-5-23(6-8-24)12-4-2-3-11(9-12)16(18,19)20/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | YEUQYVNFLWTXSN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |