C16H18N4O2 — CID 133303979
N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide (PubChem CID 133303979) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide.
| Compound Name | N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 133303979 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide |
| SMILES | CC(=O)NCCCN(C)c1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C16H18N4O2/c1-11(21)17-8-5-9-20(2)16-15-14(18-10-19-16)12-6-3-4-7-13(12)22-15/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,21) |
| InChIKey | ZQFSUROUIGQROV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|