About N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide
N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide (PubChem CID 133303979) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide |
| PubChem CID | 133303979 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide |
| SMILES | CC(=O)NCCCN(C)c1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C16H18N4O2/c1-11(21)17-8-5-9-20(2)16-15-14(18-10-19-16)12-6-3-4-7-13(12)22-15/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,21) |
| InChIKey | ZQFSUROUIGQROV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide?
The IUPAC name of N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide (CID 133303979) is N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide.
What is the SMILES notation for N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide?
The canonical SMILES for N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide is CC(=O)NCCCN(C)c1ncnc2c1oc1ccccc12.
What is the InChIKey of N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide?
The InChIKey is ZQFSUROUIGQROV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2/c1-11(21)17-8-5-9-20(2)16-15-14(18-10-19-16)12-6-3-4-7-13(12)22-15/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,21).
What are the key properties of N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide?
N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide has a molecular weight of 298.35 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[1]benzofuro[3,2-d]pyrimidin-4-yl(methyl)amino]propyl]acetamide is sourced from PubChem (CID 133303979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).