C19H14ClN5O3 — CID 133304348
[5-[(3-chloro-5-nitro-2-pyridinyl)amino]-2,3-dihydroindol-1-yl]-pyridin-3-ylmethanone (PubChem CID 133304348) has the molecular formula C19H14ClN5O3 and a molecular weight of 395.81 g/mol. Its IUPAC name is [5-[(3-chloro-5-nitro-2-pyridinyl)amino]-2,3-dihydroindol-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [5-[(3-chloro-5-nitro-2-pyridinyl)amino]-2,3-dihydroindol-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 133304348 |
| Molecular Formula | C19H14ClN5O3 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [5-[(3-chloro-5-nitro-2-pyridinyl)amino]-2,3-dihydroindol-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCc2cc(Nc3ncc([N+](=O)[O-])cc3Cl)ccc21 |
| InChI | InChI=1S/C19H14ClN5O3/c20-16-9-15(25(27)28)11-22-18(16)23-14-3-4-17-12(8-14)5-7-24(17)19(26)13-2-1-6-21-10-13/h1-4,6,8-11H,5,7H2,(H,22,23) |
| InChIKey | BWVHCVAACCKZJI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|