C14H16FN3S — CID 133305060
6-(4-fluorophenyl)-N-(3-methylsulfanylpropyl)pyridazin-3-amine (PubChem CID 133305060) has the molecular formula C14H16FN3S and a molecular weight of 277.37 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-(3-methylsulfanylpropyl)pyridazin-3-amine.
| Compound Name | 6-(4-fluorophenyl)-N-(3-methylsulfanylpropyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133305060 |
| Molecular Formula | C14H16FN3S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 6-(4-fluorophenyl)-N-(3-methylsulfanylpropyl)pyridazin-3-amine |
| SMILES | CSCCCNc1ccc(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C14H16FN3S/c1-19-10-2-9-16-14-8-7-13(17-18-14)11-3-5-12(15)6-4-11/h3-8H,2,9-10H2,1H3,(H,16,18) |
| InChIKey | XGESZDVNTWOUPV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|