About N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine
N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 133305074) has the molecular formula C9H13N5S
and a molecular weight of 223.30 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 133305074 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CSCCCNc1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C9H13N5S/c1-15-4-2-3-10-8-7-5-13-14-9(7)12-6-11-8/h5-6H,2-4H2,1H3,(H2,10,11,12,13,14) |
| InChIKey | CKSMIEYZPKRSSJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine (CID 133305074) is N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine is CSCCCNc1ncnc2[nH]ncc12.
What is the InChIKey of N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is CKSMIEYZPKRSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5S/c1-15-4-2-3-10-8-7-5-13-14-9(7)12-6-11-8/h5-6H,2-4H2,1H3,(H2,10,11,12,13,14).
What are the key properties of N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine?
N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 223.30 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylsulfanylpropyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 133305074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).