C13H7ClN4O3 — CID 133305556
6-(5-chloro-2-nitrophenoxy)pyrido[2,3-b]pyrazine (PubChem CID 133305556) has the molecular formula C13H7ClN4O3 and a molecular weight of 302.68 g/mol. Its IUPAC name is 6-(5-chloro-2-nitrophenoxy)pyrido[2,3-b]pyrazine.
| Compound Name | 6-(5-chloro-2-nitrophenoxy)pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 133305556 |
| Molecular Formula | C13H7ClN4O3 |
| Molecular Weight | 302.68 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 6-(5-chloro-2-nitrophenoxy)pyrido[2,3-b]pyrazine |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1Oc1ccc2nccnc2n1 |
| InChI | InChI=1S/C13H7ClN4O3/c14-8-1-3-10(18(19)20)11(7-8)21-12-4-2-9-13(17-12)16-6-5-15-9/h1-7H |
| InChIKey | OPIKQGZPKZVNAK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|