C18H18Cl3N5O2 — CID 133305667
4,5-dichloro-2-[3-chloro-4-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylamino]phenyl]pyridazin-3-one (PubChem CID 133305667) has the molecular formula C18H18Cl3N5O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 4,5-dichloro-2-[3-chloro-4-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylamino]phenyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[3-chloro-4-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylamino]phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 133305667 |
| Molecular Formula | C18H18Cl3N5O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 4,5-dichloro-2-[3-chloro-4-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylamino]phenyl]pyridazin-3-one |
| SMILES | CC(C)c1noc(CCCNc2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2Cl)n1 |
| InChI | InChI=1S/C18H18Cl3N5O2/c1-10(2)17-24-15(28-25-17)4-3-7-22-14-6-5-11(8-12(14)19)26-18(27)16(21)13(20)9-23-26/h5-6,8-10,22H,3-4,7H2,1-2H3 |
| InChIKey | CZTCTYRNSJNDJV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|