C15H19N5O2 — CID 133306017
N-[(3,5-dimethylpyrazolidin-4-yl)methyl]-6-nitroquinolin-2-amine (PubChem CID 133306017) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[(3,5-dimethylpyrazolidin-4-yl)methyl]-6-nitroquinolin-2-amine.
| Compound Name | N-[(3,5-dimethylpyrazolidin-4-yl)methyl]-6-nitroquinolin-2-amine |
|---|---|
| PubChem CID | 133306017 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[(3,5-dimethylpyrazolidin-4-yl)methyl]-6-nitroquinolin-2-amine |
| SMILES | CC1NNC(C)C1CNc1ccc2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C15H19N5O2/c1-9-13(10(2)19-18-9)8-16-15-6-3-11-7-12(20(21)22)4-5-14(11)17-15/h3-7,9-10,13,18-19H,8H2,1-2H3,(H,16,17) |
| InChIKey | BWNUGTYHZPUBEG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|