About 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline
8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline (PubChem CID 133306134) has the molecular formula C16H16BrN5
and a molecular weight of 358.24 g/mol. Its IUPAC name is 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline.
Molecular Properties
| Compound Name | 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline |
| PubChem CID | 133306134 |
| Molecular Formula | C16H16BrN5 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline |
| SMILES | Brc1cccc2c(N3CCC(n4cncn4)CC3)ccnc12 |
| InChI | InChI=1S/C16H16BrN5/c17-14-3-1-2-13-15(4-7-19-16(13)14)21-8-5-12(6-9-21)22-11-18-10-20-22/h1-4,7,10-12H,5-6,8-9H2 |
| InChIKey | NZWNLTQZCZPUDI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline?
The IUPAC name of 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline (CID 133306134) is 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline.
What is the SMILES notation for 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline?
The canonical SMILES for 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline is Brc1cccc2c(N3CCC(n4cncn4)CC3)ccnc12.
What is the InChIKey of 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline?
The InChIKey is NZWNLTQZCZPUDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrN5/c17-14-3-1-2-13-15(4-7-19-16(13)14)21-8-5-12(6-9-21)22-11-18-10-20-22/h1-4,7,10-12H,5-6,8-9H2.
What are the key properties of 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline?
8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline has a molecular weight of 358.24 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-4-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]quinoline is sourced from PubChem (CID 133306134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).