About 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide
5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide (PubChem CID 13330636) has the molecular formula C13H12N4O
and a molecular weight of 240.27 g/mol. Its IUPAC name is 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide.
Molecular Properties
| Compound Name | 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide |
| PubChem CID | 13330636 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide |
| SMILES | C=CCNC(=O)c1nncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H12N4O/c1-2-8-14-13(18)12-16-11(9-15-17-12)10-6-4-3-5-7-10/h2-7,9H,1,8H2,(H,14,18) |
| InChIKey | HLYKGGHQDXQYEU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide?
The IUPAC name of 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide (CID 13330636) is 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide.
What is the SMILES notation for 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide?
The canonical SMILES for 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide is C=CCNC(=O)c1nncc(-c2ccccc2)n1.
What is the InChIKey of 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide?
The InChIKey is HLYKGGHQDXQYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O/c1-2-8-14-13(18)12-16-11(9-15-17-12)10-6-4-3-5-7-10/h2-7,9H,1,8H2,(H,14,18).
What are the key properties of 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide?
5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide has a molecular weight of 240.27 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-N-prop-2-enyl-1,2,4-triazine-3-carboxamide is sourced from PubChem (CID 13330636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).