C18H21N5O — CID 133306905
1-cyclopentyl-2-[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethanol (PubChem CID 133306905) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethanol.
| Compound Name | 1-cyclopentyl-2-[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 133306905 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-cyclopentyl-2-[(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethanol |
| SMILES | OC(CNc1ncnc2c1cnn2-c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C18H21N5O/c24-16(13-6-4-5-7-13)11-19-17-15-10-22-23(18(15)21-12-20-17)14-8-2-1-3-9-14/h1-3,8-10,12-13,16,24H,4-7,11H2,(H,19,20,21) |
| InChIKey | KJGZNAXBWJRAMW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |