About 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile
4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile (PubChem CID 133307423) has the molecular formula C16H14N2S
and a molecular weight of 266.37 g/mol. Its IUPAC name is 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile |
| PubChem CID | 133307423 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CC=C(c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C16H14N2S/c17-12-13-3-5-15(6-4-13)18-9-7-14(8-10-18)16-2-1-11-19-16/h1-7,11H,8-10H2 |
| InChIKey | JEHWEJVGKNZSMP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile?
The IUPAC name of 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile (CID 133307423) is 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile.
What is the SMILES notation for 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile?
The canonical SMILES for 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile is N#Cc1ccc(N2CC=C(c3cccs3)CC2)cc1.
What is the InChIKey of 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile?
The InChIKey is JEHWEJVGKNZSMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2S/c17-12-13-3-5-15(6-4-13)18-9-7-14(8-10-18)16-2-1-11-19-16/h1-7,11H,8-10H2.
What are the key properties of 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile?
4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile has a molecular weight of 266.37 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)benzonitrile is sourced from PubChem (CID 133307423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).