C15H12ClN3O3S — CID 133308024
ethyl 4-[(2-chloro-3-pyridinyl)oxy]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 133308024) has the molecular formula C15H12ClN3O3S and a molecular weight of 349.80 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-3-pyridinyl)oxy]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-[(2-chloro-3-pyridinyl)oxy]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 133308024 |
| Molecular Formula | C15H12ClN3O3S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | ethyl 4-[(2-chloro-3-pyridinyl)oxy]-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2ncnc(Oc3cccnc3Cl)c2c1C |
| InChI | InChI=1S/C15H12ClN3O3S/c1-3-21-15(20)11-8(2)10-13(18-7-19-14(10)23-11)22-9-5-4-6-17-12(9)16/h4-7H,3H2,1-2H3 |
| InChIKey | JFLAYMAHVBYEPD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|