C15H26N4O3 — CID 133308975
N-[(2-tert-butyloxan-3-yl)methyl]-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 133308975) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(2-tert-butyloxan-3-yl)methyl]-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-[(2-tert-butyloxan-3-yl)methyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 133308975 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-[(2-tert-butyloxan-3-yl)methyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)c(NCC2CCCOC2C(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H26N4O3/c1-10-12(19(20)21)14(18(5)17-10)16-9-11-7-6-8-22-13(11)15(2,3)4/h11,13,16H,6-9H2,1-5H3 |
| InChIKey | YTRHNUIRNAHKEZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|