About 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one
3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one (PubChem CID 13330916) has the molecular formula C7H7NO3S
and a molecular weight of 185.20 g/mol. Its IUPAC name is 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one |
| PubChem CID | 13330916 |
| Molecular Formula | C7H7NO3S |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one |
| SMILES | CC(=O)n1c(=O)cc(C)oc1=S |
| InChI | InChI=1S/C7H7NO3S/c1-4-3-6(10)8(5(2)9)7(12)11-4/h3H,1-2H3 |
| InChIKey | YJDLYHJEZTTWLD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one?
The IUPAC name of 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one (CID 13330916) is 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one.
What is the SMILES notation for 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one?
The canonical SMILES for 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one is CC(=O)n1c(=O)cc(C)oc1=S.
What is the InChIKey of 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one?
The InChIKey is YJDLYHJEZTTWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3S/c1-4-3-6(10)8(5(2)9)7(12)11-4/h3H,1-2H3.
What are the key properties of 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one?
3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one has a molecular weight of 185.20 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-6-methyl-2-sulfanylidene-1,3-oxazin-4-one is sourced from PubChem (CID 13330916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).