C15H24N4O — CID 133309507
4-[[1-(4-methylpyrimidin-2-yl)piperidin-2-yl]methyl]morpholine (PubChem CID 133309507) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[[1-(4-methylpyrimidin-2-yl)piperidin-2-yl]methyl]morpholine.
| Compound Name | 4-[[1-(4-methylpyrimidin-2-yl)piperidin-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 133309507 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-[[1-(4-methylpyrimidin-2-yl)piperidin-2-yl]methyl]morpholine |
| SMILES | Cc1ccnc(N2CCCCC2CN2CCOCC2)n1 |
| InChI | InChI=1S/C15H24N4O/c1-13-5-6-16-15(17-13)19-7-3-2-4-14(19)12-18-8-10-20-11-9-18/h5-6,14H,2-4,7-12H2,1H3 |
| InChIKey | KEEHDFBWOPGZGH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |