C17H19ClN4 — CID 133309541
3-chloro-6-[[3-[[ethyl(methyl)amino]methyl]phenyl]methylamino]pyridine-2-carbonitrile (PubChem CID 133309541) has the molecular formula C17H19ClN4 and a molecular weight of 314.82 g/mol. Its IUPAC name is 3-chloro-6-[[3-[[ethyl(methyl)amino]methyl]phenyl]methylamino]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-6-[[3-[[ethyl(methyl)amino]methyl]phenyl]methylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133309541 |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-chloro-6-[[3-[[ethyl(methyl)amino]methyl]phenyl]methylamino]pyridine-2-carbonitrile |
| SMILES | CCN(C)Cc1cccc(CNc2ccc(Cl)c(C#N)n2)c1 |
| InChI | InChI=1S/C17H19ClN4/c1-3-22(2)12-14-6-4-5-13(9-14)11-20-17-8-7-15(18)16(10-19)21-17/h4-9H,3,11-12H2,1-2H3,(H,20,21) |
| InChIKey | DRXOTIPSDNIXBW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |