C16H17F3N2O2 — CID 133309828
1-(3-methylphenoxy)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol (PubChem CID 133309828) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 1-(3-methylphenoxy)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol.
| Compound Name | 1-(3-methylphenoxy)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 133309828 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-(3-methylphenoxy)-3-[[6-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol |
| SMILES | Cc1cccc(OCC(O)CNc2cccc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-11-4-2-5-13(8-11)23-10-12(22)9-20-15-7-3-6-14(21-15)16(17,18)19/h2-8,12,22H,9-10H2,1H3,(H,20,21) |
| InChIKey | MLSPDKHPKRYAGR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |