C15H12ClN5O2 — CID 133310077
6-chloro-2-[2-(2,5-dioxoimidazolidin-1-yl)ethylamino]quinoline-4-carbonitrile (PubChem CID 133310077) has the molecular formula C15H12ClN5O2 and a molecular weight of 329.75 g/mol. Its IUPAC name is 6-chloro-2-[2-(2,5-dioxoimidazolidin-1-yl)ethylamino]quinoline-4-carbonitrile.
| Compound Name | 6-chloro-2-[2-(2,5-dioxoimidazolidin-1-yl)ethylamino]quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133310077 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 6-chloro-2-[2-(2,5-dioxoimidazolidin-1-yl)ethylamino]quinoline-4-carbonitrile |
| SMILES | N#Cc1cc(NCCN2C(=O)CNC2=O)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H12ClN5O2/c16-10-1-2-12-11(6-10)9(7-17)5-13(20-12)18-3-4-21-14(22)8-19-15(21)23/h1-2,5-6H,3-4,8H2,(H,18,20)(H,19,23) |
| InChIKey | UNFZUOHUNMCPBM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|