C17H19BrN4O — CID 133311107
4-[(5-bromopyrimidin-2-yl)amino]-1-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one (PubChem CID 133311107) has the molecular formula C17H19BrN4O and a molecular weight of 375.27 g/mol. Its IUPAC name is 4-[(5-bromopyrimidin-2-yl)amino]-1-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one.
| Compound Name | 4-[(5-bromopyrimidin-2-yl)amino]-1-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
|---|---|
| PubChem CID | 133311107 |
| Molecular Formula | C17H19BrN4O |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 4-[(5-bromopyrimidin-2-yl)amino]-1-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
| SMILES | O=C(CCCNc1ncc(Br)cn1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H19BrN4O/c18-15-10-20-17(21-11-15)19-8-3-6-16(23)22-9-7-13-4-1-2-5-14(13)12-22/h1-2,4-5,10-11H,3,6-9,12H2,(H,19,20,21) |
| InChIKey | CZKYKCLRSKRGHU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|