C16H16ClN3O — CID 133311512
2-[[1-(4-chlorophenyl)-1-methoxypropan-2-yl]amino]pyridine-3-carbonitrile (PubChem CID 133311512) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)-1-methoxypropan-2-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-[[1-(4-chlorophenyl)-1-methoxypropan-2-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133311512 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)-1-methoxypropan-2-yl]amino]pyridine-3-carbonitrile |
| SMILES | COC(c1ccc(Cl)cc1)C(C)Nc1ncccc1C#N |
| InChI | InChI=1S/C16H16ClN3O/c1-11(20-16-13(10-18)4-3-9-19-16)15(21-2)12-5-7-14(17)8-6-12/h3-9,11,15H,1-2H3,(H,19,20) |
| InChIKey | GPBSEXXLEZUAGG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |