About spiro[2.4]hepta-4,6-diene-2-carbaldehyde
spiro[2.4]hepta-4,6-diene-2-carbaldehyde (PubChem CID 13331179) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is spiro[2.4]hepta-4,6-diene-2-carbaldehyde.
Molecular Properties
| Compound Name | spiro[2.4]hepta-4,6-diene-2-carbaldehyde |
| PubChem CID | 13331179 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | spiro[2.4]hepta-4,6-diene-2-carbaldehyde |
| SMILES | O=CC1CC12C=CC=C2 |
| InChI | InChI=1S/C8H8O/c9-6-7-5-8(7)3-1-2-4-8/h1-4,6-7H,5H2 |
| InChIKey | LFGGYWPAPZBNPA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze spiro[2.4]hepta-4,6-diene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.4]hepta-4,6-diene-2-carbaldehyde?
The IUPAC name of spiro[2.4]hepta-4,6-diene-2-carbaldehyde (CID 13331179) is spiro[2.4]hepta-4,6-diene-2-carbaldehyde.
What is the SMILES notation for spiro[2.4]hepta-4,6-diene-2-carbaldehyde?
The canonical SMILES for spiro[2.4]hepta-4,6-diene-2-carbaldehyde is O=CC1CC12C=CC=C2.
What is the InChIKey of spiro[2.4]hepta-4,6-diene-2-carbaldehyde?
The InChIKey is LFGGYWPAPZBNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c9-6-7-5-8(7)3-1-2-4-8/h1-4,6-7H,5H2.
What are the key properties of spiro[2.4]hepta-4,6-diene-2-carbaldehyde?
spiro[2.4]hepta-4,6-diene-2-carbaldehyde has a molecular weight of 120.15 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.4]hepta-4,6-diene-2-carbaldehyde is sourced from PubChem (CID 13331179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).