C22H28N6S — CID 133313013
N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)-2-[(dimethylamino)methyl]-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 133313013) has the molecular formula C22H28N6S and a molecular weight of 408.58 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)-2-[(dimethylamino)methyl]-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)-2-[(dimethylamino)methyl]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133313013 |
| Molecular Formula | C22H28N6S |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)-2-[(dimethylamino)methyl]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(C)Cc1nc(NC2CCC3NNCC3C2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C22H28N6S/c1-28(2)12-19-25-21(24-16-8-9-18-15(10-16)11-23-27-18)20-17(13-29-22(20)26-19)14-6-4-3-5-7-14/h3-7,13,15-16,18,23,27H,8-12H2,1-2H3,(H,24,25,26) |
| InChIKey | YTEZNAYMSONXAK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |