C20H16FN3O3 — CID 133314169
methyl 2-(5-fluoro-1,3-benzoxazol-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 133314169) has the molecular formula C20H16FN3O3 and a molecular weight of 365.36 g/mol. Its IUPAC name is methyl 2-(5-fluoro-1,3-benzoxazol-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-(5-fluoro-1,3-benzoxazol-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 133314169 |
| Molecular Formula | C20H16FN3O3 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl 2-(5-fluoro-1,3-benzoxazol-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN(c1nc2cc(F)ccc2o1)CC3 |
| InChI | InChI=1S/C20H16FN3O3/c1-26-19(25)11-2-4-15-13(8-11)14-10-24(7-6-16(14)22-15)20-23-17-9-12(21)3-5-18(17)27-20/h2-5,8-9,22H,6-7,10H2,1H3 |
| InChIKey | KJTCOUOAXONVHF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|