C17H16ClFN2O2 — CID 133314572
2-chloro-4-[1-(2-fluoro-4,5-dimethoxyphenyl)ethylamino]benzonitrile (PubChem CID 133314572) has the molecular formula C17H16ClFN2O2 and a molecular weight of 334.78 g/mol. Its IUPAC name is 2-chloro-4-[1-(2-fluoro-4,5-dimethoxyphenyl)ethylamino]benzonitrile.
| Compound Name | 2-chloro-4-[1-(2-fluoro-4,5-dimethoxyphenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133314572 |
| Molecular Formula | C17H16ClFN2O2 |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-chloro-4-[1-(2-fluoro-4,5-dimethoxyphenyl)ethylamino]benzonitrile |
| SMILES | COc1cc(F)c(C(C)Nc2ccc(C#N)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C17H16ClFN2O2/c1-10(21-12-5-4-11(9-20)14(18)6-12)13-7-16(22-2)17(23-3)8-15(13)19/h4-8,10,21H,1-3H3 |
| InChIKey | CBYWVLGEJHZZGF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |