C14H14N4S — CID 13331515
8-methyl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine (PubChem CID 13331515) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 8-methyl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine.
| Compound Name | 8-methyl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine |
|---|---|
| PubChem CID | 13331515 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 8-methyl-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine |
| SMILES | Cc1nc2sc3c(N)ncnc3c2c2c1CCCC2 |
| InChI | InChI=1S/C14H14N4S/c1-7-8-4-2-3-5-9(8)10-11-12(19-14(10)18-7)13(15)17-6-16-11/h6H,2-5H2,1H3,(H2,15,16,17) |
| InChIKey | MVWPGFJRLPTZQJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |