C20H13NO4S — CID 13331518
1-amino-2-(benzenesulfonyl)anthracene-9,10-dione (PubChem CID 13331518) has the molecular formula C20H13NO4S and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-amino-2-(benzenesulfonyl)anthracene-9,10-dione.
| Compound Name | 1-amino-2-(benzenesulfonyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 13331518 |
| Molecular Formula | C20H13NO4S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 1-amino-2-(benzenesulfonyl)anthracene-9,10-dione |
| SMILES | Nc1c(S(=O)(=O)c2ccccc2)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H13NO4S/c21-18-16(26(24,25)12-6-2-1-3-7-12)11-10-15-17(18)20(23)14-9-5-4-8-13(14)19(15)22/h1-11H,21H2 |
| InChIKey | TVEOQRWKLZDKEC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|